About N-hydroxy-5-methylidene-1,3-benzothiazol-4-imine oxide
N-hydroxy-5-methylidene-1,3-benzothiazol-4-imine oxide (PubChem CID 94044671) has the molecular formula C8H6N2O2S
and a molecular weight of 194.22 g/mol. Its IUPAC name is N-hydroxy-5-methylidene-1,3-benzothiazol-4-imine oxide.
Molecular Properties
| Compound Name | N-hydroxy-5-methylidene-1,3-benzothiazol-4-imine oxide |
| PubChem CID | 94044671 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | N-hydroxy-5-methylidene-1,3-benzothiazol-4-imine oxide |
| SMILES | C=C1C=Cc2scnc2/C1=[N+](/[O-])O |
| InChI | InChI=1S/C8H6N2O2S/c1-5-2-3-6-7(9-4-13-6)8(5)10(11)12/h2-4H,1H2,(H,11,12) |
| InChIKey | RQVNIMYMMHTASO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 59.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-5-methylidene-1,3-benzothiazol-4-imine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-5-methylidene-1,3-benzothiazol-4-imine oxide?
The IUPAC name of N-hydroxy-5-methylidene-1,3-benzothiazol-4-imine oxide (CID 94044671) is N-hydroxy-5-methylidene-1,3-benzothiazol-4-imine oxide.
What is the SMILES notation for N-hydroxy-5-methylidene-1,3-benzothiazol-4-imine oxide?
The canonical SMILES for N-hydroxy-5-methylidene-1,3-benzothiazol-4-imine oxide is C=C1C=Cc2scnc2/C1=[N+](/[O-])O.
What is the InChIKey of N-hydroxy-5-methylidene-1,3-benzothiazol-4-imine oxide?
The InChIKey is RQVNIMYMMHTASO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2S/c1-5-2-3-6-7(9-4-13-6)8(5)10(11)12/h2-4H,1H2,(H,11,12).
What are the key properties of N-hydroxy-5-methylidene-1,3-benzothiazol-4-imine oxide?
N-hydroxy-5-methylidene-1,3-benzothiazol-4-imine oxide has a molecular weight of 194.22 g/mol, XLogP of 1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-5-methylidene-1,3-benzothiazol-4-imine oxide is sourced from PubChem (CID 94044671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).