C25H26N2O4 — CID 94045565
(Z)-1-[(1S)-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 94045565) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is (Z)-1-[(1S)-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (Z)-1-[(1S)-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 94045565 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (Z)-1-[(1S)-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(OC)c(OC)cc1/C=C\C(=O)N1CCn2cccc2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H26N2O4/c1-29-21-17-23(31-3)22(30-2)16-19(21)11-12-24(28)27-15-14-26-13-7-10-20(26)25(27)18-8-5-4-6-9-18/h4-13,16-17,25H,14-15H2,1-3H3/b12-11-/t25-/m0/s1 |
| InChIKey | NNXQBLLHOAESJT-MQCQLYSJSA-N |
| XLogP | 4.16 |
| TPSA | 52.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|