C18H22N3O3+ — CID 9404711
N-[(2-methoxyphenyl)methyl]-4-morpholin-4-ylpyridin-1-ium-2-carboxamide (PubChem CID 9404711) has the molecular formula C18H22N3O3+ and a molecular weight of 328.39 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-4-morpholin-4-ylpyridin-1-ium-2-carboxamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-4-morpholin-4-ylpyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 9404711 |
| Molecular Formula | C18H22N3O3+ |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-4-morpholin-4-ylpyridin-1-ium-2-carboxamide |
| SMILES | COc1ccccc1CNC(=O)c1cc(N2CCOCC2)cc[nH+]1 |
| InChI | InChI=1S/C18H21N3O3/c1-23-17-5-3-2-4-14(17)13-20-18(22)16-12-15(6-7-19-16)21-8-10-24-11-9-21/h2-7,12H,8-11,13H2,1H3,(H,20,22)/p+1 |
| InChIKey | LLXKVMNCTNFRIT-UHFFFAOYSA-O |
| XLogP | 1.28 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |