C12H23N3O4S — CID 94049887
1-(1-methylsulfonylpiperidin-4-yl)-3-[[(3S)-oxolan-3-yl]methyl]urea (PubChem CID 94049887) has the molecular formula C12H23N3O4S and a molecular weight of 305.40 g/mol. Its IUPAC name is 1-(1-methylsulfonylpiperidin-4-yl)-3-[[(3S)-oxolan-3-yl]methyl]urea.
| Compound Name | 1-(1-methylsulfonylpiperidin-4-yl)-3-[[(3S)-oxolan-3-yl]methyl]urea |
|---|---|
| PubChem CID | 94049887 |
| Molecular Formula | C12H23N3O4S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-(1-methylsulfonylpiperidin-4-yl)-3-[[(3S)-oxolan-3-yl]methyl]urea |
| SMILES | CS(=O)(=O)N1CCC(NC(=O)NC[C@@H]2CCOC2)CC1 |
| InChI | InChI=1S/C12H23N3O4S/c1-20(17,18)15-5-2-11(3-6-15)14-12(16)13-8-10-4-7-19-9-10/h10-11H,2-9H2,1H3,(H2,13,14,16)/t10-/m0/s1 |
| InChIKey | SCXQGWWNGRNGRH-JTQLQIEISA-N |
| XLogP | -0.25 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |