C13H17NO4 — CID 9405159
2-O-ethyl 4-O-prop-2-enyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 9405159) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-O-ethyl 4-O-prop-2-enyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | 2-O-ethyl 4-O-prop-2-enyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 9405159 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-O-ethyl 4-O-prop-2-enyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | C=CCOC(=O)c1c(C)[nH]c(C(=O)OCC)c1C |
| InChI | InChI=1S/C13H17NO4/c1-5-7-18-12(15)10-8(3)11(14-9(10)4)13(16)17-6-2/h5,14H,1,6-7H2,2-4H3 |
| InChIKey | TXBRHDVSLTVQAT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|