About [(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(4-oxoquinazolin-3-yl)acetate
[(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(4-oxoquinazolin-3-yl)acetate (PubChem CID 9405860) has the molecular formula C21H18N4O5
and a molecular weight of 406.40 g/mol. Its IUPAC name is [(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(4-oxoquinazolin-3-yl)acetate.
Molecular Properties
| Compound Name | [(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(4-oxoquinazolin-3-yl)acetate |
| PubChem CID | 9405860 |
| Molecular Formula | C21H18N4O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(4-oxoquinazolin-3-yl)acetate |
| SMILES | COc1ccc(-c2nnc([C@H](C)OC(=O)Cn3cnc4ccccc4c3=O)o2)cc1 |
| InChI | InChI=1S/C21H18N4O5/c1-13(19-23-24-20(30-19)14-7-9-15(28-2)10-8-14)29-18(26)11-25-12-22-17-6-4-3-5-16(17)21(25)27/h3-10,12-13H,11H2,1-2H3/t13-/m0/s1 |
| InChIKey | BZVYKQBVZKVKBU-ZDUSSCGKSA-N |
| XLogP | 2.76 |
| TPSA | 109.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(4-oxoquinazolin-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(4-oxoquinazolin-3-yl)acetate?
The IUPAC name of [(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(4-oxoquinazolin-3-yl)acetate (CID 9405860) is [(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(4-oxoquinazolin-3-yl)acetate.
What is the SMILES notation for [(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(4-oxoquinazolin-3-yl)acetate?
The canonical SMILES for [(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(4-oxoquinazolin-3-yl)acetate is COc1ccc(-c2nnc([C@H](C)OC(=O)Cn3cnc4ccccc4c3=O)o2)cc1.
What is the InChIKey of [(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(4-oxoquinazolin-3-yl)acetate?
The InChIKey is BZVYKQBVZKVKBU-ZDUSSCGKSA-N. The full InChI is InChI=1S/C21H18N4O5/c1-13(19-23-24-20(30-19)14-7-9-15(28-2)10-8-14)29-18(26)11-25-12-22-17-6-4-3-5-16(17)21(25)27/h3-10,12-13H,11H2,1-2H3/t13-/m0/s1.
What are the key properties of [(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(4-oxoquinazolin-3-yl)acetate?
[(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(4-oxoquinazolin-3-yl)acetate has a molecular weight of 406.40 g/mol, XLogP of 2.76, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(4-oxoquinazolin-3-yl)acetate is sourced from PubChem (CID 9405860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).