C17H26N4O3 — CID 94059341
1-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]urea (PubChem CID 94059341) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]urea.
| Compound Name | 1-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 94059341 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]urea |
| SMILES | C[C@H](NC(=O)NCc1cccnc1N1CCOCC1)[C@H]1CCCO1 |
| InChI | InChI=1S/C17H26N4O3/c1-13(15-5-3-9-24-15)20-17(22)19-12-14-4-2-6-18-16(14)21-7-10-23-11-8-21/h2,4,6,13,15H,3,5,7-12H2,1H3,(H2,19,20,22)/t13-,15+/m0/s1 |
| InChIKey | JIHVBTTZERLQEY-DZGCQCFKSA-N |
| XLogP | 1.28 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |