C13H9ClN6S — CID 940599
10-(5-chloro-2-methylphenyl)-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-5-thione (PubChem CID 940599) has the molecular formula C13H9ClN6S and a molecular weight of 316.78 g/mol. Its IUPAC name is 10-(5-chloro-2-methylphenyl)-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-5-thione.
| Compound Name | 10-(5-chloro-2-methylphenyl)-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-5-thione |
|---|---|
| PubChem CID | 940599 |
| Molecular Formula | C13H9ClN6S |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 10-(5-chloro-2-methylphenyl)-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-5-thione |
| SMILES | Cc1ccc(Cl)cc1-n1ncc2c1ncn1c(=S)[nH]nc21 |
| InChI | InChI=1S/C13H9ClN6S/c1-7-2-3-8(14)4-10(7)20-11-9(5-16-20)12-17-18-13(21)19(12)6-15-11/h2-6H,1H3,(H,18,21) |
| InChIKey | ZKCTUIANCOFGOX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|