C16H23N3O2 — CID 94060517
2-[2-[[(1S,3S)-3-methylcyclohexyl]carbamoylamino]phenyl]acetamide (PubChem CID 94060517) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-[2-[[(1S,3S)-3-methylcyclohexyl]carbamoylamino]phenyl]acetamide.
| Compound Name | 2-[2-[[(1S,3S)-3-methylcyclohexyl]carbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 94060517 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-[2-[[(1S,3S)-3-methylcyclohexyl]carbamoylamino]phenyl]acetamide |
| SMILES | C[C@H]1CCC[C@H](NC(=O)Nc2ccccc2CC(N)=O)C1 |
| InChI | InChI=1S/C16H23N3O2/c1-11-5-4-7-13(9-11)18-16(21)19-14-8-3-2-6-12(14)10-15(17)20/h2-3,6,8,11,13H,4-5,7,9-10H2,1H3,(H2,17,20)(H2,18,19,21)/t11-,13-/m0/s1 |
| InChIKey | ZQXQJBCODNYRNA-AAEUAGOBSA-N |
| XLogP | 2.41 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |