C10H20N2O2 — CID 94066300
2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]-N-ethylacetamide (PubChem CID 94066300) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]-N-ethylacetamide.
| Compound Name | 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 94066300 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)CN1C[C@@H](C)OC[C@@H]1C |
| InChI | InChI=1S/C10H20N2O2/c1-4-11-10(13)6-12-5-9(3)14-7-8(12)2/h8-9H,4-7H2,1-3H3,(H,11,13)/t8-,9+/m0/s1 |
| InChIKey | YXUGPUQOOJOCPJ-DTWKUNHWSA-N |
| XLogP | 0.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |