C12H14ClN3O4 — CID 94068344
(2S)-1-(4-chloro-2,6-dinitrophenyl)-2-methylpiperidine (PubChem CID 94068344) has the molecular formula C12H14ClN3O4 and a molecular weight of 299.71 g/mol. Its IUPAC name is (2S)-1-(4-chloro-2,6-dinitrophenyl)-2-methylpiperidine.
| Compound Name | (2S)-1-(4-chloro-2,6-dinitrophenyl)-2-methylpiperidine |
|---|---|
| PubChem CID | 94068344 |
| Molecular Formula | C12H14ClN3O4 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | (2S)-1-(4-chloro-2,6-dinitrophenyl)-2-methylpiperidine |
| SMILES | C[C@H]1CCCCN1c1c([N+](=O)[O-])cc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14ClN3O4/c1-8-4-2-3-5-14(8)12-10(15(17)18)6-9(13)7-11(12)16(19)20/h6-8H,2-5H2,1H3/t8-/m0/s1 |
| InChIKey | ZSZAECIRLNOHDY-QMMMGPOBSA-N |
| XLogP | 3.54 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|