C26H35N5O2S — CID 94069547
N-[(1S)-1-(1-adamantyl)ethyl]-3-(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)propanamide (PubChem CID 94069547) has the molecular formula C26H35N5O2S and a molecular weight of 481.67 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-3-(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)propanamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-3-(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)propanamide |
|---|---|
| PubChem CID | 94069547 |
| Molecular Formula | C26H35N5O2S |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-3-(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)propanamide |
| SMILES | CCCCn1c(=O)c2sccc2n2c(CCC(=O)N[C@@H](C)C34CC5CC(CC(C5)C3)C4)nnc12 |
| InChI | InChI=1S/C26H35N5O2S/c1-3-4-8-30-24(33)23-20(7-9-34-23)31-21(28-29-25(30)31)5-6-22(32)27-16(2)26-13-17-10-18(14-26)12-19(11-17)15-26/h7,9,16-19H,3-6,8,10-15H2,1-2H3,(H,27,32)/t16-,17?,18?,19?,26?/m0/s1 |
| InChIKey | XIRGJLUXRSSSQO-BTVKBFDZSA-N |
| XLogP | 4.56 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |