C20H26N4O — CID 94069827
(1R)-N-[(1R)-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]-1,2,3,4-tetrahydronaphthalene-1-carboxamide (PubChem CID 94069827) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is (1R)-N-[(1R)-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]-1,2,3,4-tetrahydronaphthalene-1-carboxamide.
| Compound Name | (1R)-N-[(1R)-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 94069827 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (1R)-N-[(1R)-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
| SMILES | C[C@@H](NC(=O)[C@@H]1CCCc2ccccc21)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C20H26N4O/c1-14(19-23-22-18-12-3-2-6-13-24(18)19)21-20(25)17-11-7-9-15-8-4-5-10-16(15)17/h4-5,8,10,14,17H,2-3,6-7,9,11-13H2,1H3,(H,21,25)/t14-,17-/m1/s1 |
| InChIKey | NBDFSXFQIOWPJC-RHSMWYFYSA-N |
| XLogP | 3.30 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |