C18H14F3NO5 — CID 9407074
[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate (PubChem CID 9407074) has the molecular formula C18H14F3NO5 and a molecular weight of 381.31 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate.
| Compound Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
|---|---|
| PubChem CID | 9407074 |
| Molecular Formula | C18H14F3NO5 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| SMILES | C[C@@H](OC(=O)[C@@H]1COc2ccccc2O1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H14F3NO5/c1-9(17(23)22-11-7-6-10(19)15(20)16(11)21)26-18(24)14-8-25-12-4-2-3-5-13(12)27-14/h2-7,9,14H,8H2,1H3,(H,22,23)/t9-,14+/m1/s1 |
| InChIKey | ROUGZJIBOFRTLU-OTYXRUKQSA-N |
| XLogP | 2.81 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|