C24H24N4O2S2 — CID 94071325
5-benzyl-4-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]sulfanyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 94071325) has the molecular formula C24H24N4O2S2 and a molecular weight of 464.62 g/mol. Its IUPAC name is 5-benzyl-4-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]sulfanyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 5-benzyl-4-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]sulfanyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 94071325 |
| Molecular Formula | C24H24N4O2S2 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 5-benzyl-4-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]sulfanyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | C[C@@H]1CCCCN1C(=O)CSc1nc2c(sc3ncccc32)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H24N4O2S2/c1-16-8-5-6-13-27(16)19(29)15-31-24-26-20-18-11-7-12-25-22(18)32-21(20)23(30)28(24)14-17-9-3-2-4-10-17/h2-4,7,9-12,16H,5-6,8,13-15H2,1H3/t16-/m1/s1 |
| InChIKey | XRNYZQACGCLIQG-MRXNPFEDSA-N |
| XLogP | 4.55 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |