C16H9F5O4 — CID 9407283
(2,3,4,5,6-pentafluorophenyl)methyl (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate (PubChem CID 9407283) has the molecular formula C16H9F5O4 and a molecular weight of 360.23 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
|---|---|
| PubChem CID | 9407283 |
| Molecular Formula | C16H9F5O4 |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| SMILES | O=C(OCc1c(F)c(F)c(F)c(F)c1F)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C16H9F5O4/c17-11-7(12(18)14(20)15(21)13(11)19)5-24-16(22)10-6-23-8-3-1-2-4-9(8)25-10/h1-4,10H,5-6H2/t10-/m0/s1 |
| InChIKey | CJJOUYYXADOZNB-JTQLQIEISA-N |
| XLogP | 3.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|