About 2-[[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-[(2S)-butan-2-yl]acetamide
2-[[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-[(2S)-butan-2-yl]acetamide (PubChem CID 94073665) has the molecular formula C15H17BrN2O2S
and a molecular weight of 369.28 g/mol. Its IUPAC name is 2-[[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-[(2S)-butan-2-yl]acetamide.
Molecular Properties
| Compound Name | 2-[[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-[(2S)-butan-2-yl]acetamide |
| PubChem CID | 94073665 |
| Molecular Formula | C15H17BrN2O2S |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 2-[[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-[(2S)-butan-2-yl]acetamide |
| SMILES | CC[C@H](C)NC(=O)CSc1ncc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C15H17BrN2O2S/c1-3-10(2)18-14(19)9-21-15-17-8-13(20-15)11-4-6-12(16)7-5-11/h4-8,10H,3,9H2,1-2H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | SUXVVLDKTHWATM-JTQLQIEISA-N |
| XLogP | 4.11 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-[(2S)-butan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-[(2S)-butan-2-yl]acetamide?
The IUPAC name of 2-[[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-[(2S)-butan-2-yl]acetamide (CID 94073665) is 2-[[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-[(2S)-butan-2-yl]acetamide.
What is the SMILES notation for 2-[[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-[(2S)-butan-2-yl]acetamide?
The canonical SMILES for 2-[[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-[(2S)-butan-2-yl]acetamide is CC[C@H](C)NC(=O)CSc1ncc(-c2ccc(Br)cc2)o1.
What is the InChIKey of 2-[[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-[(2S)-butan-2-yl]acetamide?
The InChIKey is SUXVVLDKTHWATM-JTQLQIEISA-N. The full InChI is InChI=1S/C15H17BrN2O2S/c1-3-10(2)18-14(19)9-21-15-17-8-13(20-15)11-4-6-12(16)7-5-11/h4-8,10H,3,9H2,1-2H3,(H,18,19)/t10-/m0/s1.
What are the key properties of 2-[[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-[(2S)-butan-2-yl]acetamide?
2-[[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-[(2S)-butan-2-yl]acetamide has a molecular weight of 369.28 g/mol, XLogP of 4.11, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(4-bromophenyl)-1,3-oxazol-2-yl]sulfanyl]-N-[(2S)-butan-2-yl]acetamide is sourced from PubChem (CID 94073665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).