C16H18ClNO5 — CID 94076078
ethyl (3R)-1-(2-chloro-5-ethoxycarbonylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 94076078) has the molecular formula C16H18ClNO5 and a molecular weight of 339.78 g/mol. Its IUPAC name is ethyl (3R)-1-(2-chloro-5-ethoxycarbonylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(2-chloro-5-ethoxycarbonylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 94076078 |
| Molecular Formula | C16H18ClNO5 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | ethyl (3R)-1-(2-chloro-5-ethoxycarbonylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(Cl)c(N2C[C@H](C(=O)OCC)CC2=O)c1 |
| InChI | InChI=1S/C16H18ClNO5/c1-3-22-15(20)10-5-6-12(17)13(7-10)18-9-11(8-14(18)19)16(21)23-4-2/h5-7,11H,3-4,8-9H2,1-2H3/t11-/m1/s1 |
| InChIKey | AQAFNUBAZFMPPY-LLVKDONJSA-N |
| XLogP | 2.43 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |