C14H15ClN2O3 — CID 94076327
(3R)-5-oxo-1-[3-(propanoylamino)phenyl]pyrrolidine-3-carbonyl chloride (PubChem CID 94076327) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is (3R)-5-oxo-1-[3-(propanoylamino)phenyl]pyrrolidine-3-carbonyl chloride.
| Compound Name | (3R)-5-oxo-1-[3-(propanoylamino)phenyl]pyrrolidine-3-carbonyl chloride |
|---|---|
| PubChem CID | 94076327 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (3R)-5-oxo-1-[3-(propanoylamino)phenyl]pyrrolidine-3-carbonyl chloride |
| SMILES | CCC(=O)Nc1cccc(N2C[C@H](C(=O)Cl)CC2=O)c1 |
| InChI | InChI=1S/C14H15ClN2O3/c1-2-12(18)16-10-4-3-5-11(7-10)17-8-9(14(15)20)6-13(17)19/h3-5,7,9H,2,6,8H2,1H3,(H,16,18)/t9-/m1/s1 |
| InChIKey | FWQZQZUNVHNPIO-SECBINFHSA-N |
| XLogP | 2.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|