About 4-chloro-5-(2-chloroethyl)-2,6-dimethylpyrimidine
4-chloro-5-(2-chloroethyl)-2,6-dimethylpyrimidine (PubChem CID 94077114) has the molecular formula C8H10Cl2N2
and a molecular weight of 205.09 g/mol. Its IUPAC name is 4-chloro-5-(2-chloroethyl)-2,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 4-chloro-5-(2-chloroethyl)-2,6-dimethylpyrimidine |
| PubChem CID | 94077114 |
| Molecular Formula | C8H10Cl2N2 |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 4-chloro-5-(2-chloroethyl)-2,6-dimethylpyrimidine |
| SMILES | Cc1nc(C)c(CCCl)c(Cl)n1 |
| InChI | InChI=1S/C8H10Cl2N2/c1-5-7(3-4-9)8(10)12-6(2)11-5/h3-4H2,1-2H3 |
| InChIKey | NSEUTEVJLKUCNM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5-(2-chloroethyl)-2,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-(2-chloroethyl)-2,6-dimethylpyrimidine?
The IUPAC name of 4-chloro-5-(2-chloroethyl)-2,6-dimethylpyrimidine (CID 94077114) is 4-chloro-5-(2-chloroethyl)-2,6-dimethylpyrimidine.
What is the SMILES notation for 4-chloro-5-(2-chloroethyl)-2,6-dimethylpyrimidine?
The canonical SMILES for 4-chloro-5-(2-chloroethyl)-2,6-dimethylpyrimidine is Cc1nc(C)c(CCCl)c(Cl)n1.
What is the InChIKey of 4-chloro-5-(2-chloroethyl)-2,6-dimethylpyrimidine?
The InChIKey is NSEUTEVJLKUCNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10Cl2N2/c1-5-7(3-4-9)8(10)12-6(2)11-5/h3-4H2,1-2H3.
What are the key properties of 4-chloro-5-(2-chloroethyl)-2,6-dimethylpyrimidine?
4-chloro-5-(2-chloroethyl)-2,6-dimethylpyrimidine has a molecular weight of 205.09 g/mol, XLogP of 2.53, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-(2-chloroethyl)-2,6-dimethylpyrimidine is sourced from PubChem (CID 94077114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).