C14H21N3 — CID 94077418
4-[(3S,5R)-3,5-dimethyl-1-adamantyl]-1,2,4-triazole (PubChem CID 94077418) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 4-[(3S,5R)-3,5-dimethyl-1-adamantyl]-1,2,4-triazole.
| Compound Name | 4-[(3S,5R)-3,5-dimethyl-1-adamantyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 94077418 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 4-[(3S,5R)-3,5-dimethyl-1-adamantyl]-1,2,4-triazole |
| SMILES | C[C@]12CC3CC(n4cnnc4)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C14H21N3/c1-12-3-11-4-13(2,6-12)8-14(5-11,7-12)17-9-15-16-10-17/h9-11H,3-8H2,1-2H3/t11?,12-,13+,14? |
| InChIKey | KMONTHDUDIDOBV-AKJUYKBHSA-N |
| XLogP | 2.98 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |