C18H27N3O4 — CID 94077984
3-[(2-methoxy-3-pyridinyl)methyl]-1,1-bis[[(2S)-oxolan-2-yl]methyl]urea (PubChem CID 94077984) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-[(2-methoxy-3-pyridinyl)methyl]-1,1-bis[[(2S)-oxolan-2-yl]methyl]urea.
| Compound Name | 3-[(2-methoxy-3-pyridinyl)methyl]-1,1-bis[[(2S)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 94077984 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 3-[(2-methoxy-3-pyridinyl)methyl]-1,1-bis[[(2S)-oxolan-2-yl]methyl]urea |
| SMILES | COc1ncccc1CNC(=O)N(C[C@@H]1CCCO1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C18H27N3O4/c1-23-17-14(5-2-8-19-17)11-20-18(22)21(12-15-6-3-9-24-15)13-16-7-4-10-25-16/h2,5,8,15-16H,3-4,6-7,9-13H2,1H3,(H,20,22)/t15-,16-/m0/s1 |
| InChIKey | WSSAGZKMZYEYAT-HOTGVXAUSA-N |
| XLogP | 1.96 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |