C22H29N5O2 — CID 94080403
(3R)-N-cycloheptyl-1-(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)piperidine-3-carboxamide (PubChem CID 94080403) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is (3R)-N-cycloheptyl-1-(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-cycloheptyl-1-(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94080403 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | (3R)-N-cycloheptyl-1-(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)piperidine-3-carboxamide |
| SMILES | O=C(NC1CCCCCC1)[C@@H]1CCCN(C(=O)c2cc(-c3ccncc3)n[nH]2)C1 |
| InChI | InChI=1S/C22H29N5O2/c28-21(24-18-7-3-1-2-4-8-18)17-6-5-13-27(15-17)22(29)20-14-19(25-26-20)16-9-11-23-12-10-16/h9-12,14,17-18H,1-8,13,15H2,(H,24,28)(H,25,26)/t17-/m1/s1 |
| InChIKey | HKIFZBXZKVPRIJ-QGZVFWFLSA-N |
| XLogP | 3.16 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |