C15H18N6OS — CID 9408132
2-[(4-amino-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-N,N-bis(prop-2-enyl)acetamide (PubChem CID 9408132) has the molecular formula C15H18N6OS and a molecular weight of 330.42 g/mol. Its IUPAC name is 2-[(4-amino-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-[(4-amino-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 9408132 |
| Molecular Formula | C15H18N6OS |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-[(4-amino-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CSc1nnc(-c2cccnc2)n1N |
| InChI | InChI=1S/C15H18N6OS/c1-3-8-20(9-4-2)13(22)11-23-15-19-18-14(21(15)16)12-6-5-7-17-10-12/h3-7,10H,1-2,8-9,11,16H2 |
| InChIKey | TURIXPARKHJXHN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|