C20H18N4O2 — CID 94081377
(3S)-5-oxo-1-(pyridin-2-ylmethyl)-N-quinolin-8-ylpyrrolidine-3-carboxamide (PubChem CID 94081377) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is (3S)-5-oxo-1-(pyridin-2-ylmethyl)-N-quinolin-8-ylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-5-oxo-1-(pyridin-2-ylmethyl)-N-quinolin-8-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 94081377 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (3S)-5-oxo-1-(pyridin-2-ylmethyl)-N-quinolin-8-ylpyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cccc2cccnc12)[C@H]1CC(=O)N(Cc2ccccn2)C1 |
| InChI | InChI=1S/C20H18N4O2/c25-18-11-15(12-24(18)13-16-7-1-2-9-21-16)20(26)23-17-8-3-5-14-6-4-10-22-19(14)17/h1-10,15H,11-13H2,(H,23,26)/t15-/m0/s1 |
| InChIKey | YMEOTVZMYXVZED-HNNXBMFYSA-N |
| XLogP | 2.62 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |