C20H20ClFN2O2 — CID 94082374
(3R)-1-(2-chlorobenzoyl)-N-[(3-fluorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 94082374) has the molecular formula C20H20ClFN2O2 and a molecular weight of 374.84 g/mol. Its IUPAC name is (3R)-1-(2-chlorobenzoyl)-N-[(3-fluorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-(2-chlorobenzoyl)-N-[(3-fluorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94082374 |
| Molecular Formula | C20H20ClFN2O2 |
| Molecular Weight | 374.84 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | (3R)-1-(2-chlorobenzoyl)-N-[(3-fluorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCc1cccc(F)c1)[C@@H]1CCCN(C(=O)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C20H20ClFN2O2/c21-18-9-2-1-8-17(18)20(26)24-10-4-6-15(13-24)19(25)23-12-14-5-3-7-16(22)11-14/h1-3,5,7-9,11,15H,4,6,10,12-13H2,(H,23,25)/t15-/m1/s1 |
| InChIKey | VCKUYKYFEZGEAC-OAHLLOKOSA-N |
| XLogP | 3.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.84 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |