About (1R)-1-(2-chlorophenyl)-2-[(2R,5R)-2,5-dimethylmorpholin-4-yl]ethanol
(1R)-1-(2-chlorophenyl)-2-[(2R,5R)-2,5-dimethylmorpholin-4-yl]ethanol (PubChem CID 94083766) has the molecular formula C14H20ClNO2
and a molecular weight of 269.77 g/mol. Its IUPAC name is (1R)-1-(2-chlorophenyl)-2-[(2R,5R)-2,5-dimethylmorpholin-4-yl]ethanol.
Molecular Properties
| Compound Name | (1R)-1-(2-chlorophenyl)-2-[(2R,5R)-2,5-dimethylmorpholin-4-yl]ethanol |
| PubChem CID | 94083766 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (1R)-1-(2-chlorophenyl)-2-[(2R,5R)-2,5-dimethylmorpholin-4-yl]ethanol |
| SMILES | C[C@@H]1CN(C[C@H](O)c2ccccc2Cl)[C@H](C)CO1 |
| InChI | InChI=1S/C14H20ClNO2/c1-10-9-18-11(2)7-16(10)8-14(17)12-5-3-4-6-13(12)15/h3-6,10-11,14,17H,7-9H2,1-2H3/t10-,11-,14+/m1/s1 |
| InChIKey | KJHOSDWAUYACGZ-GYSYKLTISA-N |
| XLogP | 2.48 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-1-(2-chlorophenyl)-2-[(2R,5R)-2,5-dimethylmorpholin-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(2-chlorophenyl)-2-[(2R,5R)-2,5-dimethylmorpholin-4-yl]ethanol?
The IUPAC name of (1R)-1-(2-chlorophenyl)-2-[(2R,5R)-2,5-dimethylmorpholin-4-yl]ethanol (CID 94083766) is (1R)-1-(2-chlorophenyl)-2-[(2R,5R)-2,5-dimethylmorpholin-4-yl]ethanol.
What is the SMILES notation for (1R)-1-(2-chlorophenyl)-2-[(2R,5R)-2,5-dimethylmorpholin-4-yl]ethanol?
The canonical SMILES for (1R)-1-(2-chlorophenyl)-2-[(2R,5R)-2,5-dimethylmorpholin-4-yl]ethanol is C[C@@H]1CN(C[C@H](O)c2ccccc2Cl)[C@H](C)CO1.
What is the InChIKey of (1R)-1-(2-chlorophenyl)-2-[(2R,5R)-2,5-dimethylmorpholin-4-yl]ethanol?
The InChIKey is KJHOSDWAUYACGZ-GYSYKLTISA-N. The full InChI is InChI=1S/C14H20ClNO2/c1-10-9-18-11(2)7-16(10)8-14(17)12-5-3-4-6-13(12)15/h3-6,10-11,14,17H,7-9H2,1-2H3/t10-,11-,14+/m1/s1.
What are the key properties of (1R)-1-(2-chlorophenyl)-2-[(2R,5R)-2,5-dimethylmorpholin-4-yl]ethanol?
(1R)-1-(2-chlorophenyl)-2-[(2R,5R)-2,5-dimethylmorpholin-4-yl]ethanol has a molecular weight of 269.77 g/mol, XLogP of 2.48, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(2-chlorophenyl)-2-[(2R,5R)-2,5-dimethylmorpholin-4-yl]ethanol is sourced from PubChem (CID 94083766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).