C25H27NO4S — CID 94086129
(7R)-7-(2-butoxy-3-methoxyphenyl)-3-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one (PubChem CID 94086129) has the molecular formula C25H27NO4S and a molecular weight of 437.56 g/mol. Its IUPAC name is (7R)-7-(2-butoxy-3-methoxyphenyl)-3-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one.
| Compound Name | (7R)-7-(2-butoxy-3-methoxyphenyl)-3-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 94086129 |
| Molecular Formula | C25H27NO4S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (7R)-7-(2-butoxy-3-methoxyphenyl)-3-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
| SMILES | CCCCOc1c(OC)cccc1[C@H]1CC(=O)Nc2c(-c3ccc(OC)cc3)csc21 |
| InChI | InChI=1S/C25H27NO4S/c1-4-5-13-30-24-18(7-6-8-21(24)29-3)19-14-22(27)26-23-20(15-31-25(19)23)16-9-11-17(28-2)12-10-16/h6-12,15,19H,4-5,13-14H2,1-3H3,(H,26,27)/t19-/m1/s1 |
| InChIKey | UHKMOFIAALLFOT-LJQANCHMSA-N |
| XLogP | 6.09 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|