C22H18FNO2S — CID 94086268
(7R)-3-(2-fluorophenyl)-7-(2-prop-2-enoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one (PubChem CID 94086268) has the molecular formula C22H18FNO2S and a molecular weight of 379.46 g/mol. Its IUPAC name is (7R)-3-(2-fluorophenyl)-7-(2-prop-2-enoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one.
| Compound Name | (7R)-3-(2-fluorophenyl)-7-(2-prop-2-enoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 94086268 |
| Molecular Formula | C22H18FNO2S |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | (7R)-3-(2-fluorophenyl)-7-(2-prop-2-enoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
| SMILES | C=CCOc1ccccc1[C@H]1CC(=O)Nc2c(-c3ccccc3F)csc21 |
| InChI | InChI=1S/C22H18FNO2S/c1-2-11-26-19-10-6-4-8-15(19)16-12-20(25)24-21-17(13-27-22(16)21)14-7-3-5-9-18(14)23/h2-10,13,16H,1,11-12H2,(H,24,25)/t16-/m1/s1 |
| InChIKey | CDUNITITQAMJAK-MRXNPFEDSA-N |
| XLogP | 5.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|