C26H37ClN4O2 — CID 94089259
(2R)-N-[3-(azepan-1-yl)propyl]-2-[1-(5-chloro-1H-indole-2-carbonyl)piperidin-4-yl]propanamide (PubChem CID 94089259) has the molecular formula C26H37ClN4O2 and a molecular weight of 473.06 g/mol. Its IUPAC name is (2R)-N-[3-(azepan-1-yl)propyl]-2-[1-(5-chloro-1H-indole-2-carbonyl)piperidin-4-yl]propanamide.
| Compound Name | (2R)-N-[3-(azepan-1-yl)propyl]-2-[1-(5-chloro-1H-indole-2-carbonyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 94089259 |
| Molecular Formula | C26H37ClN4O2 |
| Molecular Weight | 473.06 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (2R)-N-[3-(azepan-1-yl)propyl]-2-[1-(5-chloro-1H-indole-2-carbonyl)piperidin-4-yl]propanamide |
| SMILES | C[C@@H](C(=O)NCCCN1CCCCCC1)C1CCN(C(=O)c2cc3cc(Cl)ccc3[nH]2)CC1 |
| InChI | InChI=1S/C26H37ClN4O2/c1-19(25(32)28-11-6-14-30-12-4-2-3-5-13-30)20-9-15-31(16-10-20)26(33)24-18-21-17-22(27)7-8-23(21)29-24/h7-8,17-20,29H,2-6,9-16H2,1H3,(H,28,32)/t19-/m1/s1 |
| InChIKey | IDQLWDOVMXWEKU-LJQANCHMSA-N |
| XLogP | 4.69 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.06 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|