C17H20N4O2S — CID 94091578
N-[(2S)-butan-2-yl]-2-(4-ethyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)acetamide (PubChem CID 94091578) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-2-(4-ethyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)acetamide.
| Compound Name | N-[(2S)-butan-2-yl]-2-(4-ethyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)acetamide |
|---|---|
| PubChem CID | 94091578 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-[(2S)-butan-2-yl]-2-(4-ethyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)acetamide |
| SMILES | CCc1nc2c(sc3ncccc32)c(=O)n1CC(=O)N[C@@H](C)CC |
| InChI | InChI=1S/C17H20N4O2S/c1-4-10(3)19-13(22)9-21-12(5-2)20-14-11-7-6-8-18-16(11)24-15(14)17(21)23/h6-8,10H,4-5,9H2,1-3H3,(H,19,22)/t10-/m0/s1 |
| InChIKey | LIKQPLYGVWGVJI-JTQLQIEISA-N |
| XLogP | 2.48 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |