About 4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzoxazin-3-one
4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzoxazin-3-one (PubChem CID 940934) has the molecular formula C14H16N2O3
and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzoxazin-3-one |
| PubChem CID | 940934 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzoxazin-3-one |
| SMILES | O=C(CN1C(=O)COc2ccccc21)N1CCCC1 |
| InChI | InChI=1S/C14H16N2O3/c17-13(15-7-3-4-8-15)9-16-11-5-1-2-6-12(11)19-10-14(16)18/h1-2,5-6H,3-4,7-10H2 |
| InChIKey | SLWWADXNGRWGCR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzoxazin-3-one?
The IUPAC name of 4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzoxazin-3-one (CID 940934) is 4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzoxazin-3-one.
What is the SMILES notation for 4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzoxazin-3-one?
The canonical SMILES for 4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzoxazin-3-one is O=C(CN1C(=O)COc2ccccc21)N1CCCC1.
What is the InChIKey of 4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzoxazin-3-one?
The InChIKey is SLWWADXNGRWGCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3/c17-13(15-7-3-4-8-15)9-16-11-5-1-2-6-12(11)19-10-14(16)18/h1-2,5-6H,3-4,7-10H2.
What are the key properties of 4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzoxazin-3-one?
4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzoxazin-3-one has a molecular weight of 260.29 g/mol, XLogP of 1.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzoxazin-3-one is sourced from PubChem (CID 940934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).