C19H25N3O4 — CID 94093428
(4R)-1-ethyl-4-[4-(3-methoxybenzoyl)piperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 94093428) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is (4R)-1-ethyl-4-[4-(3-methoxybenzoyl)piperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | (4R)-1-ethyl-4-[4-(3-methoxybenzoyl)piperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 94093428 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (4R)-1-ethyl-4-[4-(3-methoxybenzoyl)piperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | CCN1C[C@H](C(=O)N2CCN(C(=O)c3cccc(OC)c3)CC2)CC1=O |
| InChI | InChI=1S/C19H25N3O4/c1-3-20-13-15(12-17(20)23)19(25)22-9-7-21(8-10-22)18(24)14-5-4-6-16(11-14)26-2/h4-6,11,15H,3,7-10,12-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | IRIFUQSMPYYKKL-OAHLLOKOSA-N |
| XLogP | 0.85 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |