C19H16N4S — CID 9409564
N-[(E)-[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-6-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 9409564) has the molecular formula C19H16N4S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-[(E)-[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-6-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(E)-[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-6-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 9409564 |
| Molecular Formula | C19H16N4S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | N-[(E)-[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-6-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | C1=C[C@@H]2C/C(=N\Nc3ncnc4sc(-c5ccccc5)cc34)[C@@H]2C1 |
| InChI | InChI=1S/C19H16N4S/c1-2-5-12(6-3-1)17-10-15-18(20-11-21-19(15)24-17)23-22-16-9-13-7-4-8-14(13)16/h1-7,10-11,13-14H,8-9H2,(H,20,21,23)/b22-16+/t13-,14-/m1/s1 |
| InChIKey | JMVPRQFSYUCEHZ-YQBFYPLFSA-N |
| XLogP | 4.72 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|