C24H31N3O4 — CID 9409641
2-[methyl-[2-(2,4,6-trimethylphenoxy)acetyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 9409641) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-[methyl-[2-(2,4,6-trimethylphenoxy)acetyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[methyl-[2-(2,4,6-trimethylphenoxy)acetyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 9409641 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 2-[methyl-[2-(2,4,6-trimethylphenoxy)acetyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | Cc1cc(C)c(OCC(=O)N(C)CC(=O)Nc2ccc(N3CCOCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C24H31N3O4/c1-17-13-18(2)24(19(3)14-17)31-16-23(29)26(4)15-22(28)25-20-5-7-21(8-6-20)27-9-11-30-12-10-27/h5-8,13-14H,9-12,15-16H2,1-4H3,(H,25,28) |
| InChIKey | LZABERUGEXFRKC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|