C17H22N4OS — CID 94096719
(2S)-N-[[2-(dimethylamino)-4-pyridinyl]methyl]-2-thiophen-3-ylpyrrolidine-1-carboxamide (PubChem CID 94096719) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is (2S)-N-[[2-(dimethylamino)-4-pyridinyl]methyl]-2-thiophen-3-ylpyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-[[2-(dimethylamino)-4-pyridinyl]methyl]-2-thiophen-3-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 94096719 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (2S)-N-[[2-(dimethylamino)-4-pyridinyl]methyl]-2-thiophen-3-ylpyrrolidine-1-carboxamide |
| SMILES | CN(C)c1cc(CNC(=O)N2CCC[C@H]2c2ccsc2)ccn1 |
| InChI | InChI=1S/C17H22N4OS/c1-20(2)16-10-13(5-7-18-16)11-19-17(22)21-8-3-4-15(21)14-6-9-23-12-14/h5-7,9-10,12,15H,3-4,8,11H2,1-2H3,(H,19,22)/t15-/m0/s1 |
| InChIKey | GGCSPKOYUIZXFS-HNNXBMFYSA-N |
| XLogP | 3.26 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |