About [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-1,4-dioxane-2-carboxylate
[(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-1,4-dioxane-2-carboxylate (PubChem CID 94097158) has the molecular formula C21H22O5
and a molecular weight of 354.40 g/mol. Its IUPAC name is [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-1,4-dioxane-2-carboxylate.
Molecular Properties
| Compound Name | [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-1,4-dioxane-2-carboxylate |
| PubChem CID | 94097158 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-1,4-dioxane-2-carboxylate |
| SMILES | Cc1ccc(C(=O)[C@H](OC(=O)[C@H]2COCCO2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H22O5/c1-14-3-7-16(8-4-14)19(22)20(17-9-5-15(2)6-10-17)26-21(23)18-13-24-11-12-25-18/h3-10,18,20H,11-13H2,1-2H3/t18-,20-/m1/s1 |
| InChIKey | QFMBLVSSCJAVAN-UYAOXDASSA-N |
| XLogP | 3.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-1,4-dioxane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-1,4-dioxane-2-carboxylate?
The IUPAC name of [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-1,4-dioxane-2-carboxylate (CID 94097158) is [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-1,4-dioxane-2-carboxylate.
What is the SMILES notation for [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-1,4-dioxane-2-carboxylate?
The canonical SMILES for [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-1,4-dioxane-2-carboxylate is Cc1ccc(C(=O)[C@H](OC(=O)[C@H]2COCCO2)c2ccc(C)cc2)cc1.
What is the InChIKey of [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-1,4-dioxane-2-carboxylate?
The InChIKey is QFMBLVSSCJAVAN-UYAOXDASSA-N. The full InChI is InChI=1S/C21H22O5/c1-14-3-7-16(8-4-14)19(22)20(17-9-5-15(2)6-10-17)26-21(23)18-13-24-11-12-25-18/h3-10,18,20H,11-13H2,1-2H3/t18-,20-/m1/s1.
What are the key properties of [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-1,4-dioxane-2-carboxylate?
[(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-1,4-dioxane-2-carboxylate has a molecular weight of 354.40 g/mol, XLogP of 3.19, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-1,4-dioxane-2-carboxylate is sourced from PubChem (CID 94097158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).