C19H21N3O3 — CID 94099347
3-nitro-N-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]benzamide (PubChem CID 94099347) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 3-nitro-N-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]benzamide.
| Compound Name | 3-nitro-N-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 94099347 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 3-nitro-N-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1cccc(CN2CCCC2)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H21N3O3/c23-19(17-7-4-8-18(12-17)22(24)25)20-13-15-5-3-6-16(11-15)14-21-9-1-2-10-21/h3-8,11-12H,1-2,9-10,13-14H2,(H,20,23) |
| InChIKey | OMPYAXOPHKFENG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|