C21H19FN2O3S — CID 9409977
3-(benzenesulfonamido)-N-[(1S)-1-(4-fluorophenyl)ethyl]benzamide (PubChem CID 9409977) has the molecular formula C21H19FN2O3S and a molecular weight of 398.46 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-[(1S)-1-(4-fluorophenyl)ethyl]benzamide.
| Compound Name | 3-(benzenesulfonamido)-N-[(1S)-1-(4-fluorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 9409977 |
| Molecular Formula | C21H19FN2O3S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 3-(benzenesulfonamido)-N-[(1S)-1-(4-fluorophenyl)ethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1cccc(NS(=O)(=O)c2ccccc2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H19FN2O3S/c1-15(16-10-12-18(22)13-11-16)23-21(25)17-6-5-7-19(14-17)24-28(26,27)20-8-3-2-4-9-20/h2-15,24H,1H3,(H,23,25)/t15-/m0/s1 |
| InChIKey | ZBTAGZDOAKALPD-HNNXBMFYSA-N |
| XLogP | 4.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |