C13H19NOS2 — CID 94101567
N-(2-cyclopentylsulfanylethyl)-2-thiophen-2-ylacetamide (PubChem CID 94101567) has the molecular formula C13H19NOS2 and a molecular weight of 269.43 g/mol. Its IUPAC name is N-(2-cyclopentylsulfanylethyl)-2-thiophen-2-ylacetamide.
| Compound Name | N-(2-cyclopentylsulfanylethyl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 94101567 |
| Molecular Formula | C13H19NOS2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-(2-cyclopentylsulfanylethyl)-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)NCCSC1CCCC1 |
| InChI | InChI=1S/C13H19NOS2/c15-13(10-12-6-3-8-16-12)14-7-9-17-11-4-1-2-5-11/h3,6,8,11H,1-2,4-5,7,9-10H2,(H,14,15) |
| InChIKey | QNTPBTHFIZZCBT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|