C18H22N2O4 — CID 94103263
4-[2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethoxy]-3-methoxybenzonitrile (PubChem CID 94103263) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-[2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethoxy]-3-methoxybenzonitrile.
| Compound Name | 4-[2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethoxy]-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 94103263 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-[2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethoxy]-3-methoxybenzonitrile |
| SMILES | COc1cc(C#N)ccc1OCC(=O)N1CCO[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C18H22N2O4/c1-22-17-10-13(11-19)6-7-16(17)24-12-18(21)20-8-9-23-15-5-3-2-4-14(15)20/h6-7,10,14-15H,2-5,8-9,12H2,1H3/t14-,15-/m1/s1 |
| InChIKey | QUKDSZASHNFPJF-HUUCEWRRSA-N |
| XLogP | 2.12 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |