About [(3R)-2-oxooxolan-3-yl] 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetate
[(3R)-2-oxooxolan-3-yl] 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetate (PubChem CID 94103957) has the molecular formula C16H13NO5S2
and a molecular weight of 363.42 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetate.
Molecular Properties
| Compound Name | [(3R)-2-oxooxolan-3-yl] 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetate |
| PubChem CID | 94103957 |
| Molecular Formula | C16H13NO5S2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetate |
| SMILES | Cc1nc2c(cc(OCC(=O)O[C@@H]3CCOC3=O)c3ccsc32)s1 |
| InChI | InChI=1S/C16H13NO5S2/c1-8-17-14-12(24-8)6-11(9-3-5-23-15(9)14)21-7-13(18)22-10-2-4-20-16(10)19/h3,5-6,10H,2,4,7H2,1H3/t10-/m1/s1 |
| InChIKey | DRZXIUZPTRAEJJ-SNVBAGLBSA-N |
| XLogP | 3.06 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [(3R)-2-oxooxolan-3-yl] 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-2-oxooxolan-3-yl] 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetate?
The IUPAC name of [(3R)-2-oxooxolan-3-yl] 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetate (CID 94103957) is [(3R)-2-oxooxolan-3-yl] 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetate.
What is the SMILES notation for [(3R)-2-oxooxolan-3-yl] 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetate?
The canonical SMILES for [(3R)-2-oxooxolan-3-yl] 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetate is Cc1nc2c(cc(OCC(=O)O[C@@H]3CCOC3=O)c3ccsc32)s1.
What is the InChIKey of [(3R)-2-oxooxolan-3-yl] 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetate?
The InChIKey is DRZXIUZPTRAEJJ-SNVBAGLBSA-N. The full InChI is InChI=1S/C16H13NO5S2/c1-8-17-14-12(24-8)6-11(9-3-5-23-15(9)14)21-7-13(18)22-10-2-4-20-16(10)19/h3,5-6,10H,2,4,7H2,1H3/t10-/m1/s1.
What are the key properties of [(3R)-2-oxooxolan-3-yl] 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetate?
[(3R)-2-oxooxolan-3-yl] 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetate has a molecular weight of 363.42 g/mol, XLogP of 3.06, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-2-oxooxolan-3-yl] 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetate is sourced from PubChem (CID 94103957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).