C16H15F3N4O4 — CID 94108884
(E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]prop-2-enamide (PubChem CID 94108884) has the molecular formula C16H15F3N4O4 and a molecular weight of 384.31 g/mol. Its IUPAC name is (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 94108884 |
| Molecular Formula | C16H15F3N4O4 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]prop-2-enamide |
| SMILES | Cn1cc(/C=C/C(=O)Nc2ccc(OCC(F)(F)F)nc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H15F3N4O4/c1-22-8-10(14(25)23(2)15(22)26)3-5-12(24)21-11-4-6-13(20-7-11)27-9-16(17,18)19/h3-8H,9H2,1-2H3,(H,21,24)/b5-3+ |
| InChIKey | FHGWIJPKMMFGHM-HWKANZROSA-N |
| XLogP | 1.07 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|