About (1S)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide
(1S)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide (PubChem CID 94114453) has the molecular formula C13H21F3N2O
and a molecular weight of 278.32 g/mol. Its IUPAC name is (1S)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide.
Molecular Properties
| Compound Name | (1S)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide |
| PubChem CID | 94114453 |
| Molecular Formula | C13H21F3N2O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (1S)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide |
| SMILES | CN(CCCNC(=O)[C@@H]1CC=CCC1)CC(F)(F)F |
| InChI | InChI=1S/C13H21F3N2O/c1-18(10-13(14,15)16)9-5-8-17-12(19)11-6-3-2-4-7-11/h2-3,11H,4-10H2,1H3,(H,17,19)/t11-/m1/s1 |
| InChIKey | FHCITWHAQIJSDO-LLVKDONJSA-N |
| XLogP | 2.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide?
The IUPAC name of (1S)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide (CID 94114453) is (1S)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide.
What is the SMILES notation for (1S)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide?
The canonical SMILES for (1S)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide is CN(CCCNC(=O)[C@@H]1CC=CCC1)CC(F)(F)F.
What is the InChIKey of (1S)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide?
The InChIKey is FHCITWHAQIJSDO-LLVKDONJSA-N. The full InChI is InChI=1S/C13H21F3N2O/c1-18(10-13(14,15)16)9-5-8-17-12(19)11-6-3-2-4-7-11/h2-3,11H,4-10H2,1H3,(H,17,19)/t11-/m1/s1.
What are the key properties of (1S)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide?
(1S)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide has a molecular weight of 278.32 g/mol, XLogP of 2.34, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclohex-3-ene-1-carboxamide is sourced from PubChem (CID 94114453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).