C14H22N2O2 — CID 94115510
5-methyl-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]furan-2-carboxamide (PubChem CID 94115510) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 5-methyl-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]furan-2-carboxamide.
| Compound Name | 5-methyl-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 94115510 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 5-methyl-N-[2-[(3S)-3-methylpiperidin-1-yl]ethyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCN2CCC[C@H](C)C2)o1 |
| InChI | InChI=1S/C14H22N2O2/c1-11-4-3-8-16(10-11)9-7-15-14(17)13-6-5-12(2)18-13/h5-6,11H,3-4,7-10H2,1-2H3,(H,15,17)/t11-/m0/s1 |
| InChIKey | IUZRQHOSZMBFNV-NSHDSACASA-N |
| XLogP | 2.05 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |