C17H22N2O2S — CID 94120382
1-(1-benzothiophen-3-ylmethyl)-1-methyl-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea (PubChem CID 94120382) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-ylmethyl)-1-methyl-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea.
| Compound Name | 1-(1-benzothiophen-3-ylmethyl)-1-methyl-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 94120382 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-(1-benzothiophen-3-ylmethyl)-1-methyl-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea |
| SMILES | C[C@H](NC(=O)N(C)Cc1csc2ccccc12)[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H22N2O2S/c1-12(15-7-5-9-21-15)18-17(20)19(2)10-13-11-22-16-8-4-3-6-14(13)16/h3-4,6,8,11-12,15H,5,7,9-10H2,1-2H3,(H,18,20)/t12-,15-/m0/s1 |
| InChIKey | XIRMQQDNZPPQPG-WFASDCNBSA-N |
| XLogP | 3.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |