About N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide
N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide (PubChem CID 94121756) has the molecular formula C14H20N2O5
and a molecular weight of 296.32 g/mol. Its IUPAC name is N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide.
Molecular Properties
| Compound Name | N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide |
| PubChem CID | 94121756 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide |
| SMILES | C[C@@H]1CCCC[C@@H]1OCCNC(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C14H20N2O5/c1-10-4-2-3-5-11(10)20-9-8-15-14(17)12-6-7-13(21-12)16(18)19/h6-7,10-11H,2-5,8-9H2,1H3,(H,15,17)/t10-,11+/m1/s1 |
| InChIKey | IQYYRUKTGCPGSW-MNOVXSKESA-N |
| XLogP | 2.51 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide?
The IUPAC name of N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide (CID 94121756) is N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide.
What is the SMILES notation for N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide?
The canonical SMILES for N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide is C[C@@H]1CCCC[C@@H]1OCCNC(=O)c1ccc([N+](=O)[O-])o1.
What is the InChIKey of N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide?
The InChIKey is IQYYRUKTGCPGSW-MNOVXSKESA-N. The full InChI is InChI=1S/C14H20N2O5/c1-10-4-2-3-5-11(10)20-9-8-15-14(17)12-6-7-13(21-12)16(18)19/h6-7,10-11H,2-5,8-9H2,1H3,(H,15,17)/t10-,11+/m1/s1.
What are the key properties of N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide?
N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide has a molecular weight of 296.32 g/mol, XLogP of 2.51, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide is sourced from PubChem (CID 94121756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).