C14H20N2O5 — CID 94121756
N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide (PubChem CID 94121756) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 94121756 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-5-nitrofuran-2-carboxamide |
| SMILES | C[C@@H]1CCCC[C@@H]1OCCNC(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C14H20N2O5/c1-10-4-2-3-5-11(10)20-9-8-15-14(17)12-6-7-13(21-12)16(18)19/h6-7,10-11H,2-5,8-9H2,1H3,(H,15,17)/t10-,11+/m1/s1 |
| InChIKey | IQYYRUKTGCPGSW-MNOVXSKESA-N |
| XLogP | 2.51 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|