C16H20N4O — CID 94122258
(E)-2-methyl-N-[[2-(2-methylimidazol-1-yl)-4-pyridinyl]methyl]pent-2-enamide (PubChem CID 94122258) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is (E)-2-methyl-N-[[2-(2-methylimidazol-1-yl)-4-pyridinyl]methyl]pent-2-enamide.
| Compound Name | (E)-2-methyl-N-[[2-(2-methylimidazol-1-yl)-4-pyridinyl]methyl]pent-2-enamide |
|---|---|
| PubChem CID | 94122258 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (E)-2-methyl-N-[[2-(2-methylimidazol-1-yl)-4-pyridinyl]methyl]pent-2-enamide |
| SMILES | CC/C=C(\C)C(=O)NCc1ccnc(-n2ccnc2C)c1 |
| InChI | InChI=1S/C16H20N4O/c1-4-5-12(2)16(21)19-11-14-6-7-18-15(10-14)20-9-8-17-13(20)3/h5-10H,4,11H2,1-3H3,(H,19,21)/b12-5+ |
| InChIKey | UBBGWXYFVKAMCG-LFYBBSHMSA-N |
| XLogP | 2.55 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|