About (6S)-5-ethyl-6-thiophen-3-yl-6H-benzimidazolo[1,2-c]quinazoline
(6S)-5-ethyl-6-thiophen-3-yl-6H-benzimidazolo[1,2-c]quinazoline (PubChem CID 941301) has the molecular formula C20H17N3S
and a molecular weight of 331.44 g/mol. Its IUPAC name is (6S)-5-ethyl-6-thiophen-3-yl-6H-benzimidazolo[1,2-c]quinazoline.
Molecular Properties
| Compound Name | (6S)-5-ethyl-6-thiophen-3-yl-6H-benzimidazolo[1,2-c]quinazoline |
| PubChem CID | 941301 |
| Molecular Formula | C20H17N3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (6S)-5-ethyl-6-thiophen-3-yl-6H-benzimidazolo[1,2-c]quinazoline |
| SMILES | CCN1c2ccccc2-c2nc3ccccc3n2[C@H]1c1ccsc1 |
| InChI | InChI=1S/C20H17N3S/c1-2-22-17-9-5-3-7-15(17)19-21-16-8-4-6-10-18(16)23(19)20(22)14-11-12-24-13-14/h3-13,20H,2H2,1H3/t20-/m0/s1 |
| InChIKey | IWXYHGHYUJJFOK-FQEVSTJZSA-N |
| XLogP | 5.15 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6S)-5-ethyl-6-thiophen-3-yl-6H-benzimidazolo[1,2-c]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-5-ethyl-6-thiophen-3-yl-6H-benzimidazolo[1,2-c]quinazoline?
The IUPAC name of (6S)-5-ethyl-6-thiophen-3-yl-6H-benzimidazolo[1,2-c]quinazoline (CID 941301) is (6S)-5-ethyl-6-thiophen-3-yl-6H-benzimidazolo[1,2-c]quinazoline.
What is the SMILES notation for (6S)-5-ethyl-6-thiophen-3-yl-6H-benzimidazolo[1,2-c]quinazoline?
The canonical SMILES for (6S)-5-ethyl-6-thiophen-3-yl-6H-benzimidazolo[1,2-c]quinazoline is CCN1c2ccccc2-c2nc3ccccc3n2[C@H]1c1ccsc1.
What is the InChIKey of (6S)-5-ethyl-6-thiophen-3-yl-6H-benzimidazolo[1,2-c]quinazoline?
The InChIKey is IWXYHGHYUJJFOK-FQEVSTJZSA-N. The full InChI is InChI=1S/C20H17N3S/c1-2-22-17-9-5-3-7-15(17)19-21-16-8-4-6-10-18(16)23(19)20(22)14-11-12-24-13-14/h3-13,20H,2H2,1H3/t20-/m0/s1.
What are the key properties of (6S)-5-ethyl-6-thiophen-3-yl-6H-benzimidazolo[1,2-c]quinazoline?
(6S)-5-ethyl-6-thiophen-3-yl-6H-benzimidazolo[1,2-c]quinazoline has a molecular weight of 331.44 g/mol, XLogP of 5.15, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-5-ethyl-6-thiophen-3-yl-6H-benzimidazolo[1,2-c]quinazoline is sourced from PubChem (CID 941301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).