C19H28N2O3 — CID 94131690
3-methyl-N-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide (PubChem CID 94131690) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 3-methyl-N-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide.
| Compound Name | 3-methyl-N-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 94131690 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 3-methyl-N-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCO[C@H]2CCCCC2C)[nH]c2c1C(=O)CCC2 |
| InChI | InChI=1S/C19H28N2O3/c1-12-6-3-4-9-16(12)24-11-10-20-19(23)18-13(2)17-14(21-18)7-5-8-15(17)22/h12,16,21H,3-11H2,1-2H3,(H,20,23)/t12?,16-/m0/s1 |
| InChIKey | KHXWMSRRDJYIIY-INSVYWFGSA-N |
| XLogP | 3.17 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|